CAS 4498-67-3 appears in our catalog under these names: Indazole–3–carboxylic Acid, Indazole-3-carboxylic acid, 98%, 1H-Indazole-3-carboxylic Acid, Indazole-3-carboxylic acid 98%, Indazole-3-carboxylic acid, 99.89%. Offered by: GLPBio, Combi-blocks, Mikromol, Biosynth, Ambeed. Available pack sizes: 100g, 1kg, 25g, 5g, 500g, 25mg, 0,25kg, 0,5kg.
1H-indazole-3-carboxylic acid (CAS 4498-67-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-3-carboxylic acid. InChIKey: BHXVYTQDWMQVBI-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-3-carboxylic acid |
| InChIKey | BHXVYTQDWMQVBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)