cas: 6068-76-4 — see every product listed under this CAS number, including other names
2',3-Dihydroxyflavone 97% (CAS 6068-76-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A177578-250mg |
| cas | 6068-76-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 426.00 Pln | |
| Ambeed | 5g | 1138.00 Pln | |
| Ambeed | 10g | 2022.44 Pln | |
| Ambeed | 25g | 3980.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A177578 |
3-hydroxy-2-(2-hydroxyphenyl)chromen-4-one (CAS 6068-76-4) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 3-hydroxy-2-(2-hydroxyphenyl)chromen-4-one. InChIKey: VECGDSZOFMYGAF-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 3-hydroxy-2-(2-hydroxyphenyl)chromen-4-one |
| InChIKey | VECGDSZOFMYGAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C(=O)C3=CC=CC=C3O2)O)O |
Computed by PubChem (NCBI)