cas: 331760-41-9 — see every product listed under this CAS number, including other names
2',4'-Difluoro-biphenyl-4-carboxylic acid (CAS 331760-41-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F020798-500MG |
| cas | 331760-41-9 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 893.45 Pln | |
| Fluorochem | 1g | 1403.69 Pln | |
| Fluorochem | 5g | 4444.29 Pln |
| delivery time | 3-4 weeks |
|---|
4-(2,4-difluorophenyl)benzoic acid (CAS 331760-41-9) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 4-(2,4-difluorophenyl)benzoic acid. InChIKey: DGHGRAZWNAQANC-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O2 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 4-(2,4-difluorophenyl)benzoic acid |
| InChIKey | DGHGRAZWNAQANC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)