Products 331760-41-9
CAS 331760-41-9 appears in our catalog under these names: 4-(2,4-Difluorophenyl)benzoic acid, 96%, 2',4'-Difluoro-(1,1'-biphenyl)-4-carboxylic acid, 96%, 2',4'-Difluoro-biphenyl-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 500mg.
4-(2,4-difluorophenyl)benzoic acid (CAS 331760-41-9) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 4-(2,4-difluorophenyl)benzoic acid. InChIKey: DGHGRAZWNAQANC-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O2 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 4-(2,4-difluorophenyl)benzoic acid |
| InChIKey | DGHGRAZWNAQANC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(2,4-difluorophenyl)benzoic Acid, 2',4'-difluoro-[1,1'-biphenyl]-4-carboxylic acid, 2',4'-Difluoro-biphenyl-4-carboxylic acid, 2',4'-difluorobiphenyl-4-carboxylic acid, 2',4'-Difluoro-4-Biphenylcarboxylic Acid, 2',4'-difluoro[1,1'-biphenyl]-4-carboxylic acid, 2',4'-Difluoro-[1,1'-biphenyl]-4-carboxylicacid, DGHGRAZWNAQANC-UHFFFAOYSA-N