CAS 1181291-47-3 is the registry number for 3-(2,5-Difluorophenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-(2,5-difluorophenyl)benzoic acid (CAS 1181291-47-3) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 3-(2,5-difluorophenyl)benzoic acid. InChIKey: BSGYKXSOLVCGPW-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O2 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)benzoic acid |
| InChIKey | BSGYKXSOLVCGPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)