CAS 505082-81-5 appears in our catalog under these names: 4-(3,4-Difluorophenyl)benzoic acid, 96%, 3',4'-Difluoro-(1,1'-biphenyl)-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
4-(3,4-difluorophenyl)benzoic acid (CAS 505082-81-5) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 4-(3,4-difluorophenyl)benzoic acid. InChIKey: VDZUPTTUUMOUPT-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O2 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 4-(3,4-difluorophenyl)benzoic acid |
| InChIKey | VDZUPTTUUMOUPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)