CAS 1178958-75-2 is the registry number for 5-(3-Fluorophenyl)-2-fluorobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-fluoro-5-(3-fluorophenyl)benzoic acid (CAS 1178958-75-2) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 2-fluoro-5-(3-fluorophenyl)benzoic acid. InChIKey: ZOGPLQJNFXNZKX-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O2 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 2-fluoro-5-(3-fluorophenyl)benzoic acid |
| InChIKey | ZOGPLQJNFXNZKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC(=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)