Products 505082-83-7

CAS 505082-83-7 is the registry number for 4-(2-Fluorophenyl)-2-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-4-(2-fluorophenyl)benzoic acid (CAS 505082-83-7) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 2-fluoro-4-(2-fluorophenyl)benzoic acid. InChIKey: DVOWJFDWTATFLL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8F2O2
Molecular weight234.20 g/mol
IUPAC name2-fluoro-4-(2-fluorophenyl)benzoic acid
InChIKeyDVOWJFDWTATFLL-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC(=C(C=C2)C(=O)O)F)F

Computed by PubChem (NCBI)