CAS 321-31-3 appears in our catalog under these names: 3'-Chloro-2,2,2-trifluoroacetophenone, 1–(3–Chlorophenyl)–2,2,2–trifluoroethanone, 3'-Chloro-2,2,2-trifluoroacetophenone, 96%, 1-(3-Chlorophenyl)-2,2,2-trifluoroethanone, 97%, 1-(3-Chlorophenyl)-2,2,2-trifluoroethanone, 96%, 96%. Offered by: Biosynth, GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100g, 50g, 10g, 1g, 5g, 25g, 100mg, 250mg.
1-(3-chlorophenyl)-2,2,2-trifluoroethanone (CAS 321-31-3) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 1-(3-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: KYFMLRJTDPGABF-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | KYFMLRJTDPGABF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)