cas: 93-70-9 — see every product listed under this CAS number, including other names
2'-Chloroacetoacetanilide, >98.0%(HPLC)(N) (CAS 93-70-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C0624-25G |
| cas | 93-70-9 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 103.59 Pln | |
| TCI | 500g | 492.06 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
N-(2-chlorophenyl)-3-oxobutanamide (CAS 93-70-9) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: N-(2-chlorophenyl)-3-oxobutanamide. InChIKey: BFVHBHKMLIBQNN-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | N-(2-chlorophenyl)-3-oxobutanamide |
| InChIKey | BFVHBHKMLIBQNN-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=CC=CC=C1Cl |
Computed by PubChem (NCBI)