CAS 104830-08-2 appears in our catalog under these names: 3-(2-Chloro-pyridin-3-yl)-acrylic acid ethyl ester, 95%, 3-(2-Chloro-pyridin-3-yl)-acrylic acid ethyl ester, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
Ethyl (E)-3-(2-chloro-3-pyridinyl)prop-2-enoate (CAS 104830-08-2) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: ethyl (E)-3-(2-chloro-3-pyridinyl)prop-2-enoate. InChIKey: AXJQCHYUAHBXAK-AATRIKPKSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | ethyl (E)-3-(2-chloro-3-pyridinyl)prop-2-enoate |
| InChIKey | AXJQCHYUAHBXAK-AATRIKPKSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(N=CC=C1)Cl |
Computed by PubChem (NCBI)