CAS 1198401-58-9 is the registry number for (E)-Methyl 3-(2-chloro-5-methylpyridin-3-yl)-acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Methyl (E)-3-(2-chloro-5-methyl-3-pyridinyl)prop-2-enoate (CAS 1198401-58-9) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: methyl (E)-3-(2-chloro-5-methyl-3-pyridinyl)prop-2-enoate. InChIKey: KNMMNFCPGOFVTG-ONEGZZNKSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | methyl (E)-3-(2-chloro-5-methyl-3-pyridinyl)prop-2-enoate |
| InChIKey | KNMMNFCPGOFVTG-ONEGZZNKSA-N |
| SMILES | CC1=CC(=C(N=C1)Cl)/C=C/C(=O)OC |
Computed by PubChem (NCBI)