Products 711-85-3
CAS 711-85-3 appears in our catalog under these names: 5-(Chloromethyl)-3-phenyloxazolidin-2-one, 97%, 5-(Chloromethyl)-3-phenyl-1,3-oxazolidin-2-one, 5-(Chloromethyl)-3-phenyl-1,3-oxazolidin-2-one, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 10g, 5g, 2,5g, 250mg, 1g.
5-(chloromethyl)-3-phenyl-1,3-oxazolidin-2-one (CAS 711-85-3) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 5-(chloromethyl)-3-phenyl-1,3-oxazolidin-2-one. InChIKey: KARLWXPEKSFFJC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 5-(chloromethyl)-3-phenyl-1,3-oxazolidin-2-one |
| InChIKey | KARLWXPEKSFFJC-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1C2=CC=CC=C2)CCl |
Computed by PubChem (NCBI)