CAS 159153-39-6 appears in our catalog under these names: 3-(6-Chloro-pyridin-3-yl)-acrylic acid ethyl ester, 95%, (E)-Ethyl 3-(6-chloropyridin-3-yl)acrylate, 95+%, 3–(6–Chloro–pyridin–3–yl)–acrylic acid ethyl ester, 3-(6-Chloro-pyridin-3-yl)-acrylic acid ethyl ester, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
Ethyl (E)-3-(6-chloro-3-pyridinyl)prop-2-enoate (CAS 159153-39-6) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: ethyl (E)-3-(6-chloro-3-pyridinyl)prop-2-enoate. InChIKey: FHRIBCCVJCCJCZ-GQCTYLIASA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | ethyl (E)-3-(6-chloro-3-pyridinyl)prop-2-enoate |
| InChIKey | FHRIBCCVJCCJCZ-GQCTYLIASA-N |
| SMILES | CCOC(=O)/C=C/C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)