Products 1260666-35-0
CAS 1260666-35-0 appears in our catalog under these names: 1-(6-Chloropyridin-3-yl)cyclobutanecarboxylic acid, 95%, 1-(6-chloropyridin-3-yl)cyclobutanecarboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
1-(6-chloro-3-pyridinyl)cyclobutane-1-carboxylic acid (CAS 1260666-35-0) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 1-(6-chloro-3-pyridinyl)cyclobutane-1-carboxylic acid. InChIKey: TWKUGMFRFVOEEU-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 1-(6-chloro-3-pyridinyl)cyclobutane-1-carboxylic acid |
| InChIKey | TWKUGMFRFVOEEU-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CN=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)