cas: 205823-31-0 — see every product listed under this CAS number, including other names
2'-Formyl-biphenyl-3-carboxylic acid methyl ester (CAS 205823-31-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032299-1G |
| cas | 205823-31-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4173.55 Pln | |
| Fluorochem | 5g | 12378.99 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-(2-formylphenyl)benzoate (CAS 205823-31-0) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: methyl 3-(2-formylphenyl)benzoate. InChIKey: XNKYEDLHAYGZJP-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | methyl 3-(2-formylphenyl)benzoate |
| InChIKey | XNKYEDLHAYGZJP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)