CAS 36574-83-1 appears in our catalog under these names: 3,2'-Dihydroxychalcone, 95%, 3,2'-Dihydroxychalcone, 3,2'-Dihydroxychalcone, min. 95 %, 2 g, 3,2'-Dihydroxychalcone, min. 95 %, 5 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 10g, 5g, 2g.
(E)-1-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one (CAS 36574-83-1) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: (E)-1-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one. InChIKey: BLEVPIDFNNFTHJ-CMDGGOBGSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (E)-1-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | BLEVPIDFNNFTHJ-CMDGGOBGSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)/C=C/C2=CC(=CC=C2)O)O |
Computed by PubChem (NCBI)