cas: 1215206-03-3 — see every product listed under this CAS number, including other names
2'-Hydroxy-5'-methoxy-[1,1'-biphenyl]-3-carboxylic acid 95% (CAS 1215206-03-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A204469-250mg |
| cas | 1215206-03-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 1037.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A204469 |
3-(2-hydroxy-5-methoxyphenyl)benzoic acid (CAS 1215206-03-3) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 3-(2-hydroxy-5-methoxyphenyl)benzoic acid. InChIKey: MAPDAJJJYRUXGN-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 3-(2-hydroxy-5-methoxyphenyl)benzoic acid |
| InChIKey | MAPDAJJJYRUXGN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)