Products 22472-26-0
CAS 22472-26-0 appears in our catalog under these names: 2,7-Diacetoxynaphthalene, 95%, Naphthalene-2,7-diyl diacetate 95+%, Naphthalene-2,7-diyl diacetate, 98%+,RG, 98%+,RG. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g.
(7-acetyloxynaphthalen-2-yl) acetate (CAS 22472-26-0) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: (7-acetyloxynaphthalen-2-yl) acetate. InChIKey: VRMXWHJBWOVBEJ-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | (7-acetyloxynaphthalen-2-yl) acetate |
| InChIKey | VRMXWHJBWOVBEJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C=CC(=C2)OC(=O)C |
Computed by PubChem (NCBI)