cas: 1261952-79-7 — see every product listed under this CAS number, including other names
2'-Methyl-5-nitro-[1,1'-biphenyl]-3-carboxylic acid 97% (CAS 1261952-79-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A644322-100mg |
| cas | 1261952-79-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A644322 |
3-(2-methylphenyl)-5-nitrobenzoic acid (CAS 1261952-79-7) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-(2-methylphenyl)-5-nitrobenzoic acid. InChIKey: SQUAMAPZYQSOBB-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-(2-methylphenyl)-5-nitrobenzoic acid |
| InChIKey | SQUAMAPZYQSOBB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)