cas: 1261952-79-7 — see every product listed under this CAS number, including other names
2'-Methyl-5-nitro-[1,1'-biphenyl]-3-carboxylic acid, 97%, 97% (CAS 1261952-79-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111S9Y-100mg |
| cas | 1261952-79-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 770.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(2-methylphenyl)-5-nitrobenzoic acid (CAS 1261952-79-7) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-(2-methylphenyl)-5-nitrobenzoic acid. InChIKey: SQUAMAPZYQSOBB-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-(2-methylphenyl)-5-nitrobenzoic acid |
| InChIKey | SQUAMAPZYQSOBB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)