cas: 3215-92-7 — see every product listed under this CAS number, including other names
2'-Nitro-[1,1'-biphenyl]-4-carboxylic acid, 97% (CAS 3215-92-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211811-1G |
| cas | 3215-92-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 3340.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(2-nitrophenyl)benzoic acid (CAS 3215-92-7) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 4-(2-nitrophenyl)benzoic acid. InChIKey: XKGFCCZEXVIRQH-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 4-(2-nitrophenyl)benzoic acid |
| InChIKey | XKGFCCZEXVIRQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)