CAS 92-89-7 appears in our catalog under these names: 4-(4-Nitrophenyl)benzoic acid, 96%, 4–(4–Nitrophenyl)benzoic acid, 4'-NITRO[1,1'-BIPHENYL]-4-CARBOXYLIC ACID, 98%, 98%, 4'-Nitrobiphenyl-4-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 250mg, 15g.
4-(4-nitrophenyl)benzoic acid (CAS 92-89-7) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 4-(4-nitrophenyl)benzoic acid. InChIKey: LYINHPAEAYJDIR-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 4-(4-nitrophenyl)benzoic acid |
| InChIKey | LYINHPAEAYJDIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)