CAS 676339-81-4 appears in our catalog under these names: 6–(4–carboxyphenyl)nicotinic acid, 6-(4-Carboxyphenyl)nicotinic acid, 95%, 6-(4-Carboxyphenyl)nicotinic acid, 97%, 6-(4-Carboxyphenyl)nicotinic acid, 97%, 97%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-(4-carboxyphenyl)pyridine-3-carboxylic acid (CAS 676339-81-4) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 6-(4-carboxyphenyl)pyridine-3-carboxylic acid. InChIKey: BKXRBGAQGOLFPW-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 6-(4-carboxyphenyl)pyridine-3-carboxylic acid |
| InChIKey | BKXRBGAQGOLFPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)