Products 236102-72-0

CAS 236102-72-0 is the registry number for 2'-Nitrobiphenyl-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

3-(2-nitrophenyl)benzoic acid (CAS 236102-72-0) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 3-(2-nitrophenyl)benzoic acid. InChIKey: MIVOQZYLGZRQHP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9NO4
Molecular weight243.21 g/mol
IUPAC name3-(2-nitrophenyl)benzoic acid
InChIKeyMIVOQZYLGZRQHP-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC(=CC=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)