Products 959-22-8
CAS 959-22-8 appears in our catalog under these names: 4-Nitrophenyl benzoate, 95%, 4-Nitrophenyl benzoate, 4-Nitrophenyl benzoate, 98%, 98%, 4-Nitrophenyl benzoate, 5 g, 4-Nitrophenyl benzoate, 10 g. Offered by: Combi-blocks, Biosynth, Chemat, Roth, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
(4-nitrophenyl) benzoate (CAS 959-22-8) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: (4-nitrophenyl) benzoate. InChIKey: GMKZBFFLCONHDE-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | (4-nitrophenyl) benzoate |
| InChIKey | GMKZBFFLCONHDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-Nitrophenyl benzoate, p-Nitrophenyl benzoate, Benzoic acid, 4-nitrophenyl ester, Benzoic acid, p-nitrophenyl ester, (4-nitrophenyl) benzoate, 4-nitrophenylbenzoate, Phenol, p-nitro-, benzoate, benzoic acid 4-nitrophenyl ester, benzoic acid (4-nitrophenyl) ester, Benzoic acid,4-nitrophenyl ester