CAS 3215-92-7 appears in our catalog under these names: 4-(2-Nitrophenyl)benzoic acid, 96%, 2'-Nitro-[1,1'-biphenyl]-4-carboxylic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g.
4-(2-nitrophenyl)benzoic acid (CAS 3215-92-7) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 4-(2-nitrophenyl)benzoic acid. InChIKey: XKGFCCZEXVIRQH-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 4-(2-nitrophenyl)benzoic acid |
| InChIKey | XKGFCCZEXVIRQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)