cas: 198205-79-7 — see every product listed under this CAS number, including other names
2'-Trifluoromethylbiphenyl-4-carboxylic acid, 98% (CAS 198205-79-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014256-250MG |
| cas | 198205-79-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 10g | 1627.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-[2-(trifluoromethyl)phenyl]benzoic acid (CAS 198205-79-7) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 4-[2-(trifluoromethyl)phenyl]benzoic acid. InChIKey: WQKDEUGMDSTMAK-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 4-[2-(trifluoromethyl)phenyl]benzoic acid |
| InChIKey | WQKDEUGMDSTMAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)