CAS 168619-05-4 appears in our catalog under these names: 3'-(Trifluoromethyl)biphenyl-3-carboxylic acid, 96%, 3'-(Trifluoromethyl)-(1,1'-biphenyl)-3-carboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3-[3-(trifluoromethyl)phenyl]benzoic acid (CAS 168619-05-4) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]benzoic acid. InChIKey: HCHDDXZTEVLXTP-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]benzoic acid |
| InChIKey | HCHDDXZTEVLXTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)