CAS 2379322-38-8 is the registry number for 4-(Trifluoromethoxy)-[1,1'-biphenyl]-2-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-phenyl-5-(trifluoromethoxy)benzaldehyde (CAS 2379322-38-8) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 2-phenyl-5-(trifluoromethoxy)benzaldehyde. InChIKey: ZLYQHGORSARJKA-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 2-phenyl-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | ZLYQHGORSARJKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)OC(F)(F)F)C=O |
Computed by PubChem (NCBI)