CAS 168618-48-2 appears in our catalog under these names: 2'-Trifluoromethylbiphenyl-3-carboxylic acid, 97%, 2'-(Trifluoromethyl)biphenyl-3-carboxylic acid, 97%, 2'–(Trifluoromethyl)–(1,1'–biphenyl)–3–carboxylic acid, 2'-(Trifluoromethyl)-[1,1'-biphenyl]-3-carboxylic acid 97%, 2'-(Trifluoromethyl)-[1,1'-biphenyl]-3-carboxylic acid, 97%, 97%. Offered by: Fluorochem, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
3-[2-(trifluoromethyl)phenyl]benzoic acid (CAS 168618-48-2) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 3-[2-(trifluoromethyl)phenyl]benzoic acid. InChIKey: XBRHCGOUOTVEJW-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 3-[2-(trifluoromethyl)phenyl]benzoic acid |
| InChIKey | XBRHCGOUOTVEJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)