CAS 198205-79-7 appears in our catalog under these names: 4-(2-Trifluoromethylphenyl)benzoic acid, 98%, 2'-(Trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid 95%, 2'-(Trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid, 98%, 98%, 2'-Trifluoromethylbiphenyl-4-carboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-[2-(trifluoromethyl)phenyl]benzoic acid (CAS 198205-79-7) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 4-[2-(trifluoromethyl)phenyl]benzoic acid. InChIKey: WQKDEUGMDSTMAK-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 4-[2-(trifluoromethyl)phenyl]benzoic acid |
| InChIKey | WQKDEUGMDSTMAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)