CAS 1354960-66-9 is the registry number for 4-Methylphenyl 2,4,5-trifluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4-methylphenyl) 2,4,5-trifluorobenzoate (CAS 1354960-66-9) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: (4-methylphenyl) 2,4,5-trifluorobenzoate. InChIKey: CSHANYBQNMZFIG-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | (4-methylphenyl) 2,4,5-trifluorobenzoate |
| InChIKey | CSHANYBQNMZFIG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC(=O)C2=CC(=C(C=C2F)F)F |
Computed by PubChem (NCBI)