cas: 2245-53-6 — see every product listed under this CAS number, including other names
2,2'-(1,4-Phenylenebis(oxy))diacetic acid, 97%, 97% (CAS 2245-53-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5FM-1g |
| cas | 2245-53-6 |
| size | 1g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 10g | 299.60 Pln | |
| Chemat | 25g | 486.80 Pln | |
| Chemat | 100g | 1269.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[4-(carboxymethoxy)phenoxy]acetic acid (CAS 2245-53-6) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: 2-[4-(carboxymethoxy)phenoxy]acetic acid. InChIKey: DNXOCFKTVLHUMU-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 2-[4-(carboxymethoxy)phenoxy]acetic acid |
| InChIKey | DNXOCFKTVLHUMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(=O)O)OCC(=O)O |
Computed by PubChem (NCBI)