CAS 102-39-6 appears in our catalog under these names: Resorcinol-o,o'-diacetic acid, 95%, Resorcinol diacetic acid, resorcinol–o,o'–diacetic acid, Resorcinol-o,o'-diacetic acid, 2,2'-(1,3-Phenylenebis(oxy))diacetic acid, 98%, 98%. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 100mg, 25g, 10g, 50g, 100g, 250g.
2-[3-(carboxymethoxy)phenoxy]acetic acid (CAS 102-39-6) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: 2-[3-(carboxymethoxy)phenoxy]acetic acid. InChIKey: ZVMAGJJPTALGQB-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 2-[3-(carboxymethoxy)phenoxy]acetic acid |
| InChIKey | ZVMAGJJPTALGQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)OCC(=O)O |
Computed by PubChem (NCBI)