CAS 5870-37-1 appears in our catalog under these names: Dimethyl 2,5-dihydroxyterephthalate, 95%, 1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diMethyl ester, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g.
Dimethyl 2,5-dihydroxybenzene-1,4-dicarboxylate (CAS 5870-37-1) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: dimethyl 2,5-dihydroxybenzene-1,4-dicarboxylate. InChIKey: WABMHCVYKWKAAH-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | dimethyl 2,5-dihydroxybenzene-1,4-dicarboxylate |
| InChIKey | WABMHCVYKWKAAH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)C(=O)OC)O |
Computed by PubChem (NCBI)