CAS 35416-55-8 is the registry number for Dimethyl 2,6-dihydroxyterephthalate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 2,6-dihydroxybenzene-1,4-dicarboxylate (CAS 35416-55-8) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: dimethyl 2,6-dihydroxybenzene-1,4-dicarboxylate. InChIKey: NRLVOQTWTLHNPF-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | dimethyl 2,6-dihydroxybenzene-1,4-dicarboxylate |
| InChIKey | NRLVOQTWTLHNPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)O)C(=O)OC)O |
Computed by PubChem (NCBI)