CAS 2104876-04-0 is the registry number for 4-(Ethoxycarbonyl)-2,5-dihydroxybenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethoxycarbonyl-2,5-dihydroxybenzoic acid (CAS 2104876-04-0) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: 4-ethoxycarbonyl-2,5-dihydroxybenzoic acid. InChIKey: OGIYBVZHIGGCFE-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 4-ethoxycarbonyl-2,5-dihydroxybenzoic acid |
| InChIKey | OGIYBVZHIGGCFE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C(=C1)O)C(=O)O)O |
Computed by PubChem (NCBI)