Products 2104876-04-0

CAS 2104876-04-0 is the registry number for 4-(Ethoxycarbonyl)-2,5-dihydroxybenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

4-ethoxycarbonyl-2,5-dihydroxybenzoic acid (CAS 2104876-04-0) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: 4-ethoxycarbonyl-2,5-dihydroxybenzoic acid. InChIKey: OGIYBVZHIGGCFE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O6
Molecular weight226.18 g/mol
IUPAC name4-ethoxycarbonyl-2,5-dihydroxybenzoic acid
InChIKeyOGIYBVZHIGGCFE-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=C(C(=C1)O)C(=O)O)O

Computed by PubChem (NCBI)