CAS 52959-28-1 appears in our catalog under these names: Dimethyl 4,6-dihydroxyisophthalate, 97%, Dimethyl 2,4–Dihydroxybenzene–1,5–Dicarboxylate, Dimethyl 4,6-dihydroxyisophthalate, 98%, 98%, Dimethyl 4,6-dihydroxyisophthalate, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g, 50g, 100g.
Dimethyl 4,6-dihydroxybenzene-1,3-dicarboxylate (CAS 52959-28-1) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: dimethyl 4,6-dihydroxybenzene-1,3-dicarboxylate. InChIKey: CMTOZSKJCALTLF-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | dimethyl 4,6-dihydroxybenzene-1,3-dicarboxylate |
| InChIKey | CMTOZSKJCALTLF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)O)C(=O)OC |
Computed by PubChem (NCBI)