CAS 302912-28-3 appears in our catalog under these names: 2 2 2 3' 4'–PENTAFLUOROACETOPHENONE, 2,2,2,3',4'-Pentafluoroacetophenone, 95%, 2,2,2,3',4'-Pentafluoroacetophenone, ≥95%. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g.
1-(3,4-difluorophenyl)-2,2,2-trifluoroethanone (CAS 302912-28-3) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 1-(3,4-difluorophenyl)-2,2,2-trifluoroethanone. InChIKey: WEKSIOBQIQXAEE-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | WEKSIOBQIQXAEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)(F)F)F)F |
Computed by PubChem (NCBI)