cas: 126120-86-3 — see every product listed under this CAS number, including other names
2,2-DIFLUOROBENZO[D][1,3]DIOXOL-4-OL, 95% (CAS 126120-86-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F539086-250MG |
| cas | 126120-86-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1669.22 Pln | |
| Fluorochem | 1g | 3236.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,2-difluoro-1,3-benzodioxol-4-ol (CAS 126120-86-3) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,2-difluoro-1,3-benzodioxol-4-ol. InChIKey: RZLKNZQTCHZQNT-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,2-difluoro-1,3-benzodioxol-4-ol |
| InChIKey | RZLKNZQTCHZQNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)O |
Computed by PubChem (NCBI)