Products 205533-31-9
CAS 205533-31-9 appears in our catalog under these names: 4,5-Difluoro-2-hydroxybenzoic acid, 95%, 4，5–Difluoro–2–hydroxybenzoic acid, 4,5-Difluoro-2-hydroxybenzoic acid, 4,5-Difluoro-2-hydroxybenzoic acid 95%, 4,5-Difluoro-2-hydroxybenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 5g, 10g.
4,5-difluoro-2-hydroxybenzoic acid (CAS 205533-31-9) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 4,5-difluoro-2-hydroxybenzoic acid. InChIKey: LQPQOESULBOBBB-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 4,5-difluoro-2-hydroxybenzoic acid |
| InChIKey | LQPQOESULBOBBB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)O)C(=O)O |
Computed by PubChem (NCBI)