cas: 383-19-7 — see every product listed under this CAS number, including other names
2,2-Difluoro-2-phenylacetamide (CAS 383-19-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034725-1G |
| cas | 383-19-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 2.5g | 784.12 Pln | |
| Fluorochem | 5g | 1507.82 Pln | |
| Fluorochem | 10g | 2653.25 Pln |
| delivery time | 2-3 weeks |
|---|
2,2-difluoro-2-phenylacetamide (CAS 383-19-7) is a chemical compound with the molecular formula C8H7F2NO and a molecular weight of 171.14 g/mol. IUPAC name: 2,2-difluoro-2-phenylacetamide. InChIKey: QASPDCZPPDUIIE-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | 2,2-difluoro-2-phenylacetamide |
| InChIKey | QASPDCZPPDUIIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)N)(F)F |
Computed by PubChem (NCBI)