CAS 383-19-7 appears in our catalog under these names: 2,2-Difluoro-2-phenylacetamide, 95%, 2,2-Difluoro-2-phenylacetamide, 97%, 2,2-Difluoro-2-phenylacetamide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 2.5g.
2,2-difluoro-2-phenylacetamide (CAS 383-19-7) is a chemical compound with the molecular formula C8H7F2NO and a molecular weight of 171.14 g/mol. IUPAC name: 2,2-difluoro-2-phenylacetamide. InChIKey: QASPDCZPPDUIIE-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | 2,2-difluoro-2-phenylacetamide |
| InChIKey | QASPDCZPPDUIIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)N)(F)F |
Computed by PubChem (NCBI)