Products 1213895-29-4
CAS 1213895-29-4 appears in our catalog under these names: (3R)-5,7-Difluoro-2,3-dihydro-1-benzofuran-3-amine, 95%, (R)–5，7–Difluoro–2，3–dihydrobenzofuran–3–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 50mg.
(3R)-5,7-difluoro-2,3-dihydro-1-benzofuran-3-amine (CAS 1213895-29-4) is a chemical compound with the molecular formula C8H7F2NO and a molecular weight of 171.14 g/mol. IUPAC name: (3R)-5,7-difluoro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: GEGMSPAFIBENDA-ZETCQYMHSA-N.
| Molecular formula | C8H7F2NO |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | (3R)-5,7-difluoro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | GEGMSPAFIBENDA-ZETCQYMHSA-N |
| SMILES | C1[C@@H](C2=C(O1)C(=CC(=C2)F)F)N |
Computed by PubChem (NCBI)