CAS 811799-69-6 appears in our catalog under these names: 4-Amino-3,5-difluoroacetophenone, 95%, 1-(4-Amino-3,5-difluorophenyl)ethanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
1-(4-amino-3,5-difluorophenyl)ethanone (CAS 811799-69-6) is a chemical compound with the molecular formula C8H7F2NO and a molecular weight of 171.14 g/mol. IUPAC name: 1-(4-amino-3,5-difluorophenyl)ethanone. InChIKey: MLPXEMBDRBECQR-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | 1-(4-amino-3,5-difluorophenyl)ethanone |
| InChIKey | MLPXEMBDRBECQR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)F)N)F |
Computed by PubChem (NCBI)