CAS 261763-35-3 appears in our catalog under these names: 2,3-Difluoro-4-methylbenzamide, 95%, 2,3-Difluoro-4-methylbenzamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2,3-difluoro-4-methylbenzamide (CAS 261763-35-3) is a chemical compound with the molecular formula C8H7F2NO and a molecular weight of 171.14 g/mol. IUPAC name: 2,3-difluoro-4-methylbenzamide. InChIKey: JWPKXGWPXBRCLL-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | 2,3-difluoro-4-methylbenzamide |
| InChIKey | JWPKXGWPXBRCLL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)N)F)F |
Computed by PubChem (NCBI)