CAS 1006608-67-8 appears in our catalog under these names: 2-(2,6-Difluorophenyl)acetamide, 95%, 2-(2,6-Difluorophenyl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
2-(2,6-difluorophenyl)acetamide (CAS 1006608-67-8) is a chemical compound with the molecular formula C8H7F2NO and a molecular weight of 171.14 g/mol. IUPAC name: 2-(2,6-difluorophenyl)acetamide. InChIKey: DEKLINATNSGZGE-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)acetamide |
| InChIKey | DEKLINATNSGZGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CC(=O)N)F |
Computed by PubChem (NCBI)