cas: 126120-86-3 — see every product listed under this CAS number, including other names
2,2-Difluorobenzo[d][1,3]dioxol-4-ol 95% (CAS 126120-86-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A854648-100mg |
| cas | 126120-86-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1366.06 Pln | |
| Ambeed | 5g | 3902.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A854648 |
2,2-difluoro-1,3-benzodioxol-4-ol (CAS 126120-86-3) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,2-difluoro-1,3-benzodioxol-4-ol. InChIKey: RZLKNZQTCHZQNT-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,2-difluoro-1,3-benzodioxol-4-ol |
| InChIKey | RZLKNZQTCHZQNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)O |
Computed by PubChem (NCBI)