cas: 69187-60-6 — see every product listed under this CAS number, including other names
2,2-Dimethyl-1-phenylpropan-1-amine hydrochloride, 95%, 95% (CAS 69187-60-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KKG7-250mg |
| cas | 69187-60-6 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 741.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride (CAS 69187-60-6) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride. InChIKey: BMOFDSTXFQCVDC-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride |
| InChIKey | BMOFDSTXFQCVDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)